Lasofoxifene-D4 β-D-Glucuronide
● Auf Lager
| Katalog-Nr.:: | DVE002133 |
|---|---|
| CAS-Nr.:: | N/A |
| Summenformel:: | C34H35D4NO8 |
| Molare Masse:: | 593.7 g/mol |
Zusätzliche Informationen zu
Parent drug
LasofoxifeneIUPAC-Name
(5R,6S)-5,6,7,8-Tetrahydro-6-phenyl-5-[4-[2-(1-pyrrolidinyl)ethoxy-d4]phenyl]-2-naphthalen β-D-Glucopyranosiduronic AcidPharmacopeial Synonyms
N/ASynonyme
N/ASMILES
O=C(C1O[C@@H](OC2=CC=C3[C@@H](C4=CC=C(OC([2H])([2H])C([2H])([2H])N5CCCC5)C=C4)[C@@H](C6=CC=CC=C6)CCC3=C2)[C@@H](O)[C@@H](O)[C@@H]1O)OInChI
InChI=1S/C34H39NO8/c36-29-30(37)32(33(39)40)43-34(31(29)38)42-25-13-15-27-23(20-25)10-14-26(21-6-2-1-3-7-21)28(27)22-8-11-24(12-9-22)41-19-18-35-16-4-5-17-35/h1-3,6-9,11-13,15,20,26,28-32,34,36-38H,4-5,10,14,16-19H2,(H,39,40)/t26-,28+,29+,30+,31+,32?,34-/m1/s1/i18D2,19D2Beschreibung
Lasofoxifene-D4 β-D-Glucuronide is an analytically significant impurity arising from deuterated lasofoxifene undergoing O- or N-glucuronidation during synthesis or metabolic mimicry. This polar glucuronide conjugate can affect batch purity and analytical quantitation, and requires targeted impurity profiling by LC-MS/MS, high resolution MS and proton and deuterium NMR for structural confirmation. Control strategies include optimized enzymatic or chemical deprotection steps, improved chromatographic separation, and validated stability-indicating methods to monitor formation under forced degradation. Reporting, identification and qualification thresholds should follow ICH Q3A and Q3B guidance to mitigate safety or pharmacokinetic impact in drug substance development.Angebot anfordern
„*“ zeigt erforderliche Felder an




