| Parent Drug Name | Name of Impurity | Catalogue No. | |
|---|---|---|---|
| Cysteine | S-Adenosyl-L-Homocysteine Impurity | VE0011580 | View CAS 979-92-0 |
Cysteine Impurities
| Parent Drug Name | Name of Impurity | Catalogue No. | |
|---|---|---|---|
| Cysteine | S-Adenosyl-L-Homocysteine Impurity | VE0011580 | View CAS 979-92-0 |
| Catalogue No. | VE0011580 |
| CAS No. | 979-92-0 |
| Molecular Formula | C14H20N6O5S |
| Molecular Weight | 384.41 g/mol |
| Parent drug | Cysteine |
| IUPAC Name | (2S)-2-amino-4-({[(2S, 3S, 4R, 5R)-5-(6-amino-9H-purin-9-yl)-3, 4-dihydroxyoxolan-2-yl]methyl}sulfanyl)butanoic acid |
| Synonyms | N/A |
| Smiles | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CSCCC(C(=O)O)N)O)O)N |
| References | |
| Status | In-stock |
| ListName | S-Adenosyl-L-Homocysteine Impurity |
| Exclusively Supplied by Veeprho | Exclusively Supplied by Veeprho |
"*" indicates required fields
